C27H25N3O — CID 174193130
5-(3-aminoanilino)-2-methyl-N-(1-naphthalen-1-ylcyclopropyl)benzamide (PubChem CID 174193130) has the molecular formula C27H25N3O and a molecular weight of 407.52 g/mol. Its IUPAC name is 5-(3-aminoanilino)-2-methyl-N-(1-naphthalen-1-ylcyclopropyl)benzamide.
| Compound Name | 5-(3-aminoanilino)-2-methyl-N-(1-naphthalen-1-ylcyclopropyl)benzamide |
|---|---|
| PubChem CID | 174193130 |
| Molecular Formula | C27H25N3O |
| Molecular Weight | 407.52 g/mol |
| Exact Mass | 407.20 |
| IUPAC Name | 5-(3-aminoanilino)-2-methyl-N-(1-naphthalen-1-ylcyclopropyl)benzamide |
| SMILES | Cc1ccc(Nc2cccc(N)c2)cc1C(=O)NC1(c2cccc3ccccc23)CC1 |
| InChI | InChI=1S/C27H25N3O/c1-18-12-13-22(29-21-9-5-8-20(28)16-21)17-24(18)26(31)30-27(14-15-27)25-11-4-7-19-6-2-3-10-23(19)25/h2-13,16-17,29H,14-15,28H2,1H3,(H,30,31) |
| InChIKey | YZGYUDBNTREMJX-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 67.15 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.52 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|