C26H28FN3O — CID 177268874
N-[1-(4-fluoronaphthalen-1-yl)cyclopropyl]-2-methyl-5-(piperidin-4-ylamino)benzamide (PubChem CID 177268874) has the molecular formula C26H28FN3O and a molecular weight of 417.53 g/mol. Its IUPAC name is N-[1-(4-fluoronaphthalen-1-yl)cyclopropyl]-2-methyl-5-(piperidin-4-ylamino)benzamide.
| Compound Name | N-[1-(4-fluoronaphthalen-1-yl)cyclopropyl]-2-methyl-5-(piperidin-4-ylamino)benzamide |
|---|---|
| PubChem CID | 177268874 |
| Molecular Formula | C26H28FN3O |
| Molecular Weight | 417.53 g/mol |
| Exact Mass | 417.22 |
| IUPAC Name | N-[1-(4-fluoronaphthalen-1-yl)cyclopropyl]-2-methyl-5-(piperidin-4-ylamino)benzamide |
| SMILES | Cc1ccc(NC2CCNCC2)cc1C(=O)NC1(c2ccc(F)c3ccccc23)CC1 |
| InChI | InChI=1S/C26H28FN3O/c1-17-6-7-19(29-18-10-14-28-15-11-18)16-22(17)25(31)30-26(12-13-26)23-8-9-24(27)21-5-3-2-4-20(21)23/h2-9,16,18,28-29H,10-15H2,1H3,(H,30,31) |
| InChIKey | GEEWKPTXCPWAOL-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 53.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.53 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |