About [[2-(4-bromophenyl)-3,3-difluoropropyl]amino]-tert-butyl-oxidosulfanium
[[2-(4-bromophenyl)-3,3-difluoropropyl]amino]-tert-butyl-oxidosulfanium (PubChem CID 174194646) has the molecular formula C13H18BrF2NOS
and a molecular weight of 354.26 g/mol. Its IUPAC name is [[2-(4-bromophenyl)-3,3-difluoropropyl]amino]-tert-butyl-oxidosulfanium.
Molecular Properties
| Compound Name | [[2-(4-bromophenyl)-3,3-difluoropropyl]amino]-tert-butyl-oxidosulfanium |
| PubChem CID | 174194646 |
| Molecular Formula | C13H18BrF2NOS |
| Molecular Weight | 354.26 g/mol |
| Exact Mass | 353.03 |
| IUPAC Name | [[2-(4-bromophenyl)-3,3-difluoropropyl]amino]-tert-butyl-oxidosulfanium |
| SMILES | CC(C)(C)[S+]([O-])NCC(c1ccc(Br)cc1)C(F)F |
| InChI | InChI=1S/C13H18BrF2NOS/c1-13(2,3)19(18)17-8-11(12(15)16)9-4-6-10(14)7-5-9/h4-7,11-12,17H,8H2,1-3H3 |
| InChIKey | SAQGQNXTVXQZNZ-UHFFFAOYSA-N |
| XLogP | 3.85 |
| TPSA | 35.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 354.26 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|
Analyze [[2-(4-bromophenyl)-3,3-difluoropropyl]amino]-tert-butyl-oxidosulfanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [[2-(4-bromophenyl)-3,3-difluoropropyl]amino]-tert-butyl-oxidosulfanium?
The IUPAC name of [[2-(4-bromophenyl)-3,3-difluoropropyl]amino]-tert-butyl-oxidosulfanium (CID 174194646) is [[2-(4-bromophenyl)-3,3-difluoropropyl]amino]-tert-butyl-oxidosulfanium.
What is the SMILES notation for [[2-(4-bromophenyl)-3,3-difluoropropyl]amino]-tert-butyl-oxidosulfanium?
The canonical SMILES for [[2-(4-bromophenyl)-3,3-difluoropropyl]amino]-tert-butyl-oxidosulfanium is CC(C)(C)[S+]([O-])NCC(c1ccc(Br)cc1)C(F)F.
What is the InChIKey of [[2-(4-bromophenyl)-3,3-difluoropropyl]amino]-tert-butyl-oxidosulfanium?
The InChIKey is SAQGQNXTVXQZNZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H18BrF2NOS/c1-13(2,3)19(18)17-8-11(12(15)16)9-4-6-10(14)7-5-9/h4-7,11-12,17H,8H2,1-3H3.
What are the key properties of [[2-(4-bromophenyl)-3,3-difluoropropyl]amino]-tert-butyl-oxidosulfanium?
[[2-(4-bromophenyl)-3,3-difluoropropyl]amino]-tert-butyl-oxidosulfanium has a molecular weight of 354.26 g/mol, XLogP of 3.85, 5 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [[2-(4-bromophenyl)-3,3-difluoropropyl]amino]-tert-butyl-oxidosulfanium is sourced from PubChem (CID 174194646), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).