C36H34BF2N13O11P2S — CID 174194981
CID 174194981 (PubChem CID 174194981) has the molecular formula C36H34BF2N13O11P2S and a molecular weight of 967.57 g/mol.
| Compound Name | CID 174194981 |
|---|---|
| PubChem CID | 174194981 |
| Molecular Formula | C36H34BF2N13O11P2S |
| Molecular Weight | 967.57 g/mol |
| Exact Mass | 967.18 |
| IUPAC Name | — |
| SMILES | [B][P@]1(=O)OC[C@H]2O[C@@H](n3cnc4c(N)ncnc43)[C@H](F)[C@@H]2O[P@@](=O)(SCc2ccc(OC(=O)c3ccc(OCCN=[N+]=[N-])cc3)cc2)OC[C@H]2O[C@@H](n3cnc4c(N)ncnc43)[C@H](F)[C@@H]2O1 |
| InChI | InChI=1S/C36H34BF2N13O11P2S/c37-64(54)57-11-22-29(25(39)35(60-22)52-17-48-27-31(41)44-15-46-33(27)52)63-65(55,58-12-23-28(62-64)24(38)34(61-23)51-16-47-26-30(40)43-14-45-32(26)51)66-13-18-1-5-21(6-2-18)59-36(53)19-3-7-20(8-4-19)56-10-9-49-50-42/h1-8,14-17,22-25,28-29,34-35H,9-13H2,(H2,40,43,45)(H2,41,44,46)/t22-,23-,24-,25-,28-,29-,34-,35-,64+,65+/m1/s1 |
| InChIKey | OTRWQTZJKVOKHY-LIWNGCORSA-N |
| XLogP | 5.35 |
| TPSA | 313.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 23 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 66 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 967.57 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 23 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|