C35H42BF2N9O11P2S — CID 174195137
CID 174195137 (PubChem CID 174195137) has the molecular formula C35H42BF2N9O11P2S and a molecular weight of 907.60 g/mol.
| Compound Name | CID 174195137 |
|---|---|
| PubChem CID | 174195137 |
| Molecular Formula | C35H42BF2N9O11P2S |
| Molecular Weight | 907.60 g/mol |
| Exact Mass | 907.23 |
| IUPAC Name | — |
| SMILES | [B][P@@]1(=O)OC[C@H]2O[C@@H](n3cnc4c(N)ccnc43)[C@H](F)[C@@H]2O[P@](=O)(SCc2ccc(COCCOCCOCC)cc2)OC[C@H]2O[C@@H](n3cnc4c(N)ncnc43)[C@H](F)[C@@H]2O1 |
| InChI | InChI=1S/C35H42BF2N9O11P2S/c1-2-50-9-10-51-11-12-52-13-20-3-5-21(6-4-20)16-61-60(49)54-15-24-29(25(37)34(56-24)47-19-45-28-31(40)42-17-43-33(28)47)57-59(36,48)53-14-23-30(58-60)26(38)35(55-23)46-18-44-27-22(39)7-8-41-32(27)46/h3-8,17-19,23-26,29-30,34-35H,2,9-16H2,1H3,(H2,39,41)(H2,40,42,43)/t23-,24-,25-,26-,29-,30-,34-,35-,59-,60-/m1/s1 |
| InChIKey | BVBYMUNCZLYHBL-IGTXWXBLSA-N |
| XLogP | 4.61 |
| TPSA | 243.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 21 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 61 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 907.60 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 21 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|