C53H56BF2N13O12P2S — CID 174195144
CID 174195144 (PubChem CID 174195144) has the molecular formula C53H56BF2N13O12P2S and a molecular weight of 1209.93 g/mol.
| Compound Name | CID 174195144 |
|---|---|
| PubChem CID | 174195144 |
| Molecular Formula | C53H56BF2N13O12P2S |
| Molecular Weight | 1209.93 g/mol |
| Exact Mass | 1209.34 |
| IUPAC Name | — |
| SMILES | [B][P@]1(=O)OC[C@H]2O[C@@H](n3cnc4c(N)ccnc43)[C@H](F)[C@@H]2O[P@@](=O)(SCc2ccc(COCCOCCOCCn3nnc4c3-c3ccccc3CN(C(=O)CC)c3ccccc3-4)cc2)OC[C@H]2O[C@@H](n3cnc4c(N)ncnc43)[C@H](F)[C@@H]2O1 |
| InChI | InChI=1S/C53H56BF2N13O12P2S/c1-2-40(70)66-23-33-7-3-4-8-34(33)46-43(35-9-5-6-10-37(35)66)64-65-69(46)17-18-73-19-20-74-21-22-75-24-31-11-13-32(14-12-31)27-84-83(72)77-26-39-47(41(55)52(79-39)68-30-63-45-49(58)60-28-61-51(45)68)80-82(54,71)76-25-38-48(81-83)42(56)53(78-38)67-29-62-44-36(57)15-16-59-50(44)67/h3-16,28-30,38-39,41-42,47-48,52-53H,2,17-27H2,1H3,(H2,57,59)(H2,58,60,61)/t38-,39-,41-,42-,47-,48-,52-,53-,82+,83+/m1/s1 |
| InChIKey | YQJFUMYBKZWLOK-ZPWCTCFCSA-N |
| XLogP | 7.47 |
| TPSA | 294.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 25 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 84 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1209.93 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 25 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|