C33H42N2 — CID 174195295
2-[(2R)-6-ethenyl-1,2,3,4-tetrahydronaphthalen-2-yl]-N,5-diethyl-N-[[4-[2-(ethylamino)ethyl]phenyl]methyl]aniline (PubChem CID 174195295) has the molecular formula C33H42N2 and a molecular weight of 466.71 g/mol. Its IUPAC name is 2-[(2R)-6-ethenyl-1,2,3,4-tetrahydronaphthalen-2-yl]-N,5-diethyl-N-[[4-[2-(ethylamino)ethyl]phenyl]methyl]aniline.
| Compound Name | 2-[(2R)-6-ethenyl-1,2,3,4-tetrahydronaphthalen-2-yl]-N,5-diethyl-N-[[4-[2-(ethylamino)ethyl]phenyl]methyl]aniline |
|---|---|
| PubChem CID | 174195295 |
| Molecular Formula | C33H42N2 |
| Molecular Weight | 466.71 g/mol |
| Exact Mass | 466.33 |
| IUPAC Name | 2-[(2R)-6-ethenyl-1,2,3,4-tetrahydronaphthalen-2-yl]-N,5-diethyl-N-[[4-[2-(ethylamino)ethyl]phenyl]methyl]aniline |
| SMILES | C=Cc1ccc2c(c1)CC[C@@H](c1ccc(CC)cc1N(CC)Cc1ccc(CCNCC)cc1)C2 |
| InChI | InChI=1S/C33H42N2/c1-5-25-13-15-30-23-31(17-16-29(30)21-25)32-18-14-26(6-2)22-33(32)35(8-4)24-28-11-9-27(10-12-28)19-20-34-7-3/h5,9-15,18,21-22,31,34H,1,6-8,16-17,19-20,23-24H2,2-4H3/t31-/m1/s1 |
| InChIKey | RDLIVYMQWDFZKI-WJOKGBTCSA-N |
| XLogP | 7.34 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.71 |
| LogP ≤ 5 | 7.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|