C40H46N2O6 — CID 174196514
[(1R,8S,15R,16S)-16-[4-(butylamino)benzoyl]oxy-1,8-dimethoxy-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,10,12-pentaenyl] 4-(1-aminobutyl)benzoate (PubChem CID 174196514) has the molecular formula C40H46N2O6 and a molecular weight of 650.82 g/mol. Its IUPAC name is [(1R,8S,15R,16S)-16-[4-(butylamino)benzoyl]oxy-1,8-dimethoxy-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,10,12-pentaenyl] 4-(1-aminobutyl)benzoate.
| Compound Name | [(1R,8S,15R,16S)-16-[4-(butylamino)benzoyl]oxy-1,8-dimethoxy-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,10,12-pentaenyl] 4-(1-aminobutyl)benzoate |
|---|---|
| PubChem CID | 174196514 |
| Molecular Formula | C40H46N2O6 |
| Molecular Weight | 650.82 g/mol |
| Exact Mass | 650.34 |
| IUPAC Name | [(1R,8S,15R,16S)-16-[4-(butylamino)benzoyl]oxy-1,8-dimethoxy-15-tetracyclo[6.6.2.02,7.09,14]hexadeca-2,4,6,10,12-pentaenyl] 4-(1-aminobutyl)benzoate |
| SMILES | CCCCNc1ccc(C(=O)O[C@H]2[C@@H](OC(=O)c3ccc(C(N)CCC)cc3)[C@]3(OC)c4ccccc4[C@@]2(OC)C2C=CC=CC23)cc1 |
| InChI | InChI=1S/C40H46N2O6/c1-5-7-25-42-29-23-21-28(22-24-29)38(44)48-36-35(47-37(43)27-19-17-26(18-20-27)34(41)12-6-2)39(45-3)30-13-8-10-15-32(30)40(36,46-4)33-16-11-9-14-31(33)39/h8-11,13-24,30,32,34-36,42H,5-7,12,25,41H2,1-4H3/t30?,32?,34?,35-,36+,39-,40+/m1/s1 |
| InChIKey | XXEKZRHJZFAPPV-UERRSVBRSA-N |
| XLogP | 7.22 |
| TPSA | 109.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 650.82 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|