About 5-ethyl-2,7-di(propan-2-yl)pyrrolo[2,3-b]pyrazine
5-ethyl-2,7-di(propan-2-yl)pyrrolo[2,3-b]pyrazine (PubChem CID 174196547) has the molecular formula C14H21N3
and a molecular weight of 231.34 g/mol. Its IUPAC name is 5-ethyl-2,7-di(propan-2-yl)pyrrolo[2,3-b]pyrazine.
Molecular Properties
| Compound Name | 5-ethyl-2,7-di(propan-2-yl)pyrrolo[2,3-b]pyrazine |
| PubChem CID | 174196547 |
| Molecular Formula | C14H21N3 |
| Molecular Weight | 231.34 g/mol |
| Exact Mass | 231.17 |
| IUPAC Name | 5-ethyl-2,7-di(propan-2-yl)pyrrolo[2,3-b]pyrazine |
| SMILES | CCn1cc(C(C)C)c2nc(C(C)C)cnc21 |
| InChI | InChI=1S/C14H21N3/c1-6-17-8-11(9(2)3)13-14(17)15-7-12(16-13)10(4)5/h7-10H,6H2,1-5H3 |
| InChIKey | NMZBAFQJRGMWSN-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 30.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.34 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 5-ethyl-2,7-di(propan-2-yl)pyrrolo[2,3-b]pyrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-ethyl-2,7-di(propan-2-yl)pyrrolo[2,3-b]pyrazine?
The IUPAC name of 5-ethyl-2,7-di(propan-2-yl)pyrrolo[2,3-b]pyrazine (CID 174196547) is 5-ethyl-2,7-di(propan-2-yl)pyrrolo[2,3-b]pyrazine.
What is the SMILES notation for 5-ethyl-2,7-di(propan-2-yl)pyrrolo[2,3-b]pyrazine?
The canonical SMILES for 5-ethyl-2,7-di(propan-2-yl)pyrrolo[2,3-b]pyrazine is CCn1cc(C(C)C)c2nc(C(C)C)cnc21.
What is the InChIKey of 5-ethyl-2,7-di(propan-2-yl)pyrrolo[2,3-b]pyrazine?
The InChIKey is NMZBAFQJRGMWSN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H21N3/c1-6-17-8-11(9(2)3)13-14(17)15-7-12(16-13)10(4)5/h7-10H,6H2,1-5H3.
What are the key properties of 5-ethyl-2,7-di(propan-2-yl)pyrrolo[2,3-b]pyrazine?
5-ethyl-2,7-di(propan-2-yl)pyrrolo[2,3-b]pyrazine has a molecular weight of 231.34 g/mol, XLogP of 3.70, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-ethyl-2,7-di(propan-2-yl)pyrrolo[2,3-b]pyrazine is sourced from PubChem (CID 174196547), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).