C23H30N4O — CID 174196887
N-[1-(5-amino-2,3-dimethylphenyl)ethyl]-6-methoxy-2-methyl-7-propylquinazolin-4-amine (PubChem CID 174196887) has the molecular formula C23H30N4O and a molecular weight of 378.52 g/mol. Its IUPAC name is N-[1-(5-amino-2,3-dimethylphenyl)ethyl]-6-methoxy-2-methyl-7-propylquinazolin-4-amine.
| Compound Name | N-[1-(5-amino-2,3-dimethylphenyl)ethyl]-6-methoxy-2-methyl-7-propylquinazolin-4-amine |
|---|---|
| PubChem CID | 174196887 |
| Molecular Formula | C23H30N4O |
| Molecular Weight | 378.52 g/mol |
| Exact Mass | 378.24 |
| IUPAC Name | N-[1-(5-amino-2,3-dimethylphenyl)ethyl]-6-methoxy-2-methyl-7-propylquinazolin-4-amine |
| SMILES | CCCc1cc2nc(C)nc(NC(C)c3cc(N)cc(C)c3C)c2cc1OC |
| InChI | InChI=1S/C23H30N4O/c1-7-8-17-10-21-20(12-22(17)28-6)23(27-16(5)26-21)25-15(4)19-11-18(24)9-13(2)14(19)3/h9-12,15H,7-8,24H2,1-6H3,(H,25,26,27) |
| InChIKey | AWBBVSMEDLUMJB-UHFFFAOYSA-N |
| XLogP | 5.27 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.52 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|