C27H33BrN4O — CID 165134820
7-(9-aminonon-7-ynyl)-N-[(1R)-1-(3-bromophenyl)ethyl]-6-methoxy-2-methylquinazolin-4-amine (PubChem CID 165134820) has the molecular formula C27H33BrN4O and a molecular weight of 509.49 g/mol. Its IUPAC name is 7-(9-aminonon-7-ynyl)-N-[(1R)-1-(3-bromophenyl)ethyl]-6-methoxy-2-methylquinazolin-4-amine.
| Compound Name | 7-(9-aminonon-7-ynyl)-N-[(1R)-1-(3-bromophenyl)ethyl]-6-methoxy-2-methylquinazolin-4-amine |
|---|---|
| PubChem CID | 165134820 |
| Molecular Formula | C27H33BrN4O |
| Molecular Weight | 509.49 g/mol |
| Exact Mass | 508.18 |
| IUPAC Name | 7-(9-aminonon-7-ynyl)-N-[(1R)-1-(3-bromophenyl)ethyl]-6-methoxy-2-methylquinazolin-4-amine |
| SMILES | COc1cc2c(N[C@H](C)c3cccc(Br)c3)nc(C)nc2cc1CCCCCCC#CCN |
| InChI | InChI=1S/C27H33BrN4O/c1-19(21-13-11-14-23(28)16-21)30-27-24-18-26(33-3)22(17-25(24)31-20(2)32-27)12-9-7-5-4-6-8-10-15-29/h11,13-14,16-19H,4-7,9,12,15,29H2,1-3H3,(H,30,31,32)/t19-/m1/s1 |
| InChIKey | RPBYTHJTTBPXMY-LJQANCHMSA-N |
| XLogP | 6.34 |
| TPSA | 73.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.49 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|