C21H26BrN5O — CID 146197349
N-[(1R)-1-(3-bromophenyl)ethyl]-6-[3-(dimethylamino)propoxy]-2-methylpyrido[3,4-d]pyrimidin-4-amine (PubChem CID 146197349) has the molecular formula C21H26BrN5O and a molecular weight of 444.38 g/mol. Its IUPAC name is N-[(1R)-1-(3-bromophenyl)ethyl]-6-[3-(dimethylamino)propoxy]-2-methylpyrido[3,4-d]pyrimidin-4-amine.
| Compound Name | N-[(1R)-1-(3-bromophenyl)ethyl]-6-[3-(dimethylamino)propoxy]-2-methylpyrido[3,4-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 146197349 |
| Molecular Formula | C21H26BrN5O |
| Molecular Weight | 444.38 g/mol |
| Exact Mass | 443.13 |
| IUPAC Name | N-[(1R)-1-(3-bromophenyl)ethyl]-6-[3-(dimethylamino)propoxy]-2-methylpyrido[3,4-d]pyrimidin-4-amine |
| SMILES | Cc1nc(N[C@H](C)c2cccc(Br)c2)c2cc(OCCCN(C)C)ncc2n1 |
| InChI | InChI=1S/C21H26BrN5O/c1-14(16-7-5-8-17(22)11-16)24-21-18-12-20(28-10-6-9-27(3)4)23-13-19(18)25-15(2)26-21/h5,7-8,11-14H,6,9-10H2,1-4H3,(H,24,25,26)/t14-/m1/s1 |
| InChIKey | ITBKXXWVIKLOTA-CQSZACIVSA-N |
| XLogP | 4.60 |
| TPSA | 63.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.38 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|