C40H45BrN4O3 — CID 171735456
N-[7-[4-[1-(3-bromophenyl)ethylamino]-6-methoxy-2-methylquinazolin-7-yl]oxyheptyl]-3,3-diphenylpropanamide (PubChem CID 171735456) has the molecular formula C40H45BrN4O3 and a molecular weight of 709.73 g/mol. Its IUPAC name is N-[7-[4-[1-(3-bromophenyl)ethylamino]-6-methoxy-2-methylquinazolin-7-yl]oxyheptyl]-3,3-diphenylpropanamide.
| Compound Name | N-[7-[4-[1-(3-bromophenyl)ethylamino]-6-methoxy-2-methylquinazolin-7-yl]oxyheptyl]-3,3-diphenylpropanamide |
|---|---|
| PubChem CID | 171735456 |
| Molecular Formula | C40H45BrN4O3 |
| Molecular Weight | 709.73 g/mol |
| Exact Mass | 708.27 |
| IUPAC Name | N-[7-[4-[1-(3-bromophenyl)ethylamino]-6-methoxy-2-methylquinazolin-7-yl]oxyheptyl]-3,3-diphenylpropanamide |
| SMILES | COc1cc2c(NC(C)c3cccc(Br)c3)nc(C)nc2cc1OCCCCCCCNC(=O)CC(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C40H45BrN4O3/c1-28(32-20-15-21-33(41)24-32)43-40-35-25-37(47-3)38(27-36(35)44-29(2)45-40)48-23-14-6-4-5-13-22-42-39(46)26-34(30-16-9-7-10-17-30)31-18-11-8-12-19-31/h7-12,15-21,24-25,27-28,34H,4-6,13-14,22-23,26H2,1-3H3,(H,42,46)(H,43,44,45) |
| InChIKey | PXSIMKSUGZIYRQ-UHFFFAOYSA-N |
| XLogP | 9.55 |
| TPSA | 85.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 709.73 |
| LogP ≤ 5 | 9.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|