C27H35BrN4O4 — CID 166536441
7-[4-[[(1R)-1-(3-bromophenyl)ethyl]amino]-6-methoxy-2-methylquinazolin-7-yl]oxy-N-methoxy-N-methylheptanamide (PubChem CID 166536441) has the molecular formula C27H35BrN4O4 and a molecular weight of 559.51 g/mol. Its IUPAC name is 7-[4-[[(1R)-1-(3-bromophenyl)ethyl]amino]-6-methoxy-2-methylquinazolin-7-yl]oxy-N-methoxy-N-methylheptanamide.
| Compound Name | 7-[4-[[(1R)-1-(3-bromophenyl)ethyl]amino]-6-methoxy-2-methylquinazolin-7-yl]oxy-N-methoxy-N-methylheptanamide |
|---|---|
| PubChem CID | 166536441 |
| Molecular Formula | C27H35BrN4O4 |
| Molecular Weight | 559.51 g/mol |
| Exact Mass | 558.18 |
| IUPAC Name | 7-[4-[[(1R)-1-(3-bromophenyl)ethyl]amino]-6-methoxy-2-methylquinazolin-7-yl]oxy-N-methoxy-N-methylheptanamide |
| SMILES | COc1cc2c(N[C@H](C)c3cccc(Br)c3)nc(C)nc2cc1OCCCCCCC(=O)N(C)OC |
| InChI | InChI=1S/C27H35BrN4O4/c1-18(20-11-10-12-21(28)15-20)29-27-22-16-24(34-4)25(17-23(22)30-19(2)31-27)36-14-9-7-6-8-13-26(33)32(3)35-5/h10-12,15-18H,6-9,13-14H2,1-5H3,(H,29,30,31)/t18-/m1/s1 |
| InChIKey | QLNFGBNIFXMOJS-GOSISDBHSA-N |
| XLogP | 6.23 |
| TPSA | 85.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.51 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|