C26H32BrN3O4 — CID 174175512
7-[4-[1-(3-bromophenyl)ethylamino]-6,7-dimethoxy-2-methylquinazolin-8-yl]heptanoic acid (PubChem CID 174175512) has the molecular formula C26H32BrN3O4 and a molecular weight of 530.46 g/mol. Its IUPAC name is 7-[4-[1-(3-bromophenyl)ethylamino]-6,7-dimethoxy-2-methylquinazolin-8-yl]heptanoic acid.
| Compound Name | 7-[4-[1-(3-bromophenyl)ethylamino]-6,7-dimethoxy-2-methylquinazolin-8-yl]heptanoic acid |
|---|---|
| PubChem CID | 174175512 |
| Molecular Formula | C26H32BrN3O4 |
| Molecular Weight | 530.46 g/mol |
| Exact Mass | 529.16 |
| IUPAC Name | 7-[4-[1-(3-bromophenyl)ethylamino]-6,7-dimethoxy-2-methylquinazolin-8-yl]heptanoic acid |
| SMILES | COc1cc2c(NC(C)c3cccc(Br)c3)nc(C)nc2c(CCCCCCC(=O)O)c1OC |
| InChI | InChI=1S/C26H32BrN3O4/c1-16(18-10-9-11-19(27)14-18)28-26-21-15-22(33-3)25(34-4)20(24(21)29-17(2)30-26)12-7-5-6-8-13-23(31)32/h9-11,14-16H,5-8,12-13H2,1-4H3,(H,31,32)(H,28,29,30) |
| InChIKey | WNMDIHPANJMTBO-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 93.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.46 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|