C27H36BrN3O4S — CID 169066918
methyl 9-[4-[[(1S)-1-(4-bromothiophen-2-yl)ethyl]amino]-6,7-dimethoxy-2-methylquinazolin-8-yl]nonanoate (PubChem CID 169066918) has the molecular formula C27H36BrN3O4S and a molecular weight of 578.57 g/mol. Its IUPAC name is methyl 9-[4-[[(1S)-1-(4-bromothiophen-2-yl)ethyl]amino]-6,7-dimethoxy-2-methylquinazolin-8-yl]nonanoate.
| Compound Name | methyl 9-[4-[[(1S)-1-(4-bromothiophen-2-yl)ethyl]amino]-6,7-dimethoxy-2-methylquinazolin-8-yl]nonanoate |
|---|---|
| PubChem CID | 169066918 |
| Molecular Formula | C27H36BrN3O4S |
| Molecular Weight | 578.57 g/mol |
| Exact Mass | 577.16 |
| IUPAC Name | methyl 9-[4-[[(1S)-1-(4-bromothiophen-2-yl)ethyl]amino]-6,7-dimethoxy-2-methylquinazolin-8-yl]nonanoate |
| SMILES | COC(=O)CCCCCCCCc1c(OC)c(OC)cc2c(N[C@@H](C)c3cc(Br)cs3)nc(C)nc12 |
| InChI | InChI=1S/C27H36BrN3O4S/c1-17(23-14-19(28)16-36-23)29-27-21-15-22(33-3)26(35-5)20(25(21)30-18(2)31-27)12-10-8-6-7-9-11-13-24(32)34-4/h14-17H,6-13H2,1-5H3,(H,29,30,31)/t17-/m0/s1 |
| InChIKey | KLDAJZWQMFNDAW-KRWDZBQOSA-N |
| XLogP | 7.40 |
| TPSA | 82.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.57 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|