C33H46N6O — CID 174197176
4-[[2-ethenyl-5-[2-[1-[[4-[(2Z)-2-(2-iminoethylidene)hydrazinyl]phenyl]methyl]piperidin-2-yl]ethyl]phenyl]methyl-methylamino]-5-(methylamino)hex-5-enal (PubChem CID 174197176) has the molecular formula C33H46N6O and a molecular weight of 542.77 g/mol. Its IUPAC name is 4-[[2-ethenyl-5-[2-[1-[[4-[(2Z)-2-(2-iminoethylidene)hydrazinyl]phenyl]methyl]piperidin-2-yl]ethyl]phenyl]methyl-methylamino]-5-(methylamino)hex-5-enal.
| Compound Name | 4-[[2-ethenyl-5-[2-[1-[[4-[(2Z)-2-(2-iminoethylidene)hydrazinyl]phenyl]methyl]piperidin-2-yl]ethyl]phenyl]methyl-methylamino]-5-(methylamino)hex-5-enal |
|---|---|
| PubChem CID | 174197176 |
| Molecular Formula | C33H46N6O |
| Molecular Weight | 542.77 g/mol |
| Exact Mass | 542.37 |
| IUPAC Name | 4-[[2-ethenyl-5-[2-[1-[[4-[(2Z)-2-(2-iminoethylidene)hydrazinyl]phenyl]methyl]piperidin-2-yl]ethyl]phenyl]methyl-methylamino]-5-(methylamino)hex-5-enal |
| SMILES | [H]/N=C/C=N\Nc1ccc(CN2CCCCC2CCc2ccc(C=C)c(CN(C)C(CCC=O)C(=C)NC)c2)cc1 |
| InChI | InChI=1S/C33H46N6O/c1-5-29-15-11-27(23-30(29)25-38(4)33(10-8-22-40)26(2)35-3)14-18-32-9-6-7-21-39(32)24-28-12-16-31(17-13-28)37-36-20-19-34/h5,11-13,15-17,19-20,22-23,32-35,37H,1-2,6-10,14,18,21,24-25H2,3-4H3/b34-19+,36-20- |
| InChIKey | BHOXTOJVXADQKZ-XXLMPMCMSA-N |
| XLogP | 5.88 |
| TPSA | 83.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.77 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|