C30H39N3S — CID 174197754
S-[4-[[2-[2-(2-hepta-1,6-dien-3-yl-1-methylidene-3H-isoindol-5-yl)ethyl]piperidin-1-yl]methyl]phenyl]thiohydroxylamine (PubChem CID 174197754) has the molecular formula C30H39N3S and a molecular weight of 473.73 g/mol. Its IUPAC name is S-[4-[[2-[2-(2-hepta-1,6-dien-3-yl-1-methylidene-3H-isoindol-5-yl)ethyl]piperidin-1-yl]methyl]phenyl]thiohydroxylamine.
| Compound Name | S-[4-[[2-[2-(2-hepta-1,6-dien-3-yl-1-methylidene-3H-isoindol-5-yl)ethyl]piperidin-1-yl]methyl]phenyl]thiohydroxylamine |
|---|---|
| PubChem CID | 174197754 |
| Molecular Formula | C30H39N3S |
| Molecular Weight | 473.73 g/mol |
| Exact Mass | 473.29 |
| IUPAC Name | S-[4-[[2-[2-(2-hepta-1,6-dien-3-yl-1-methylidene-3H-isoindol-5-yl)ethyl]piperidin-1-yl]methyl]phenyl]thiohydroxylamine |
| SMILES | C=CCCC(C=C)N1Cc2cc(CCC3CCCCN3Cc3ccc(SN)cc3)ccc2C1=C |
| InChI | InChI=1S/C30H39N3S/c1-4-6-9-27(5-2)33-22-26-20-24(14-18-30(26)23(33)3)11-15-28-10-7-8-19-32(28)21-25-12-16-29(34-31)17-13-25/h4-5,12-14,16-18,20,27-28H,1-3,6-11,15,19,21-22,31H2 |
| InChIKey | ODBWBFDQJLNXMT-UHFFFAOYSA-N |
| XLogP | 6.95 |
| TPSA | 32.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.73 |
| LogP ≤ 5 | 6.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|