C22H29N3O2 — CID 174200328
3-[3-methylidene-6-[2-(1-methylpiperidin-2-yl)ethyl]-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 174200328) has the molecular formula C22H29N3O2 and a molecular weight of 367.49 g/mol. Its IUPAC name is 3-[3-methylidene-6-[2-(1-methylpiperidin-2-yl)ethyl]-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-methylidene-6-[2-(1-methylpiperidin-2-yl)ethyl]-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 174200328 |
| Molecular Formula | C22H29N3O2 |
| Molecular Weight | 367.49 g/mol |
| Exact Mass | 367.23 |
| IUPAC Name | 3-[3-methylidene-6-[2-(1-methylpiperidin-2-yl)ethyl]-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | C=C1c2ccc(CCC3CCCCN3C)cc2CN1C1CCC(=O)NC1=O |
| InChI | InChI=1S/C22H29N3O2/c1-15-19-9-7-16(6-8-18-5-3-4-12-24(18)2)13-17(19)14-25(15)20-10-11-21(26)23-22(20)27/h7,9,13,18,20H,1,3-6,8,10-12,14H2,2H3,(H,23,26,27) |
| InChIKey | KVQHDOHHFFUZKS-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.49 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|