C22H28N2O3 — CID 167471236
3-[3-methylidene-6-[3-[(2-methylpropan-2-yl)oxy]but-3-enyl]-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 167471236) has the molecular formula C22H28N2O3 and a molecular weight of 368.48 g/mol. Its IUPAC name is 3-[3-methylidene-6-[3-[(2-methylpropan-2-yl)oxy]but-3-enyl]-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-methylidene-6-[3-[(2-methylpropan-2-yl)oxy]but-3-enyl]-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 167471236 |
| Molecular Formula | C22H28N2O3 |
| Molecular Weight | 368.48 g/mol |
| Exact Mass | 368.21 |
| IUPAC Name | 3-[3-methylidene-6-[3-[(2-methylpropan-2-yl)oxy]but-3-enyl]-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | C=C(CCc1ccc2c(c1)CN(C1CCC(=O)NC1=O)C2=C)OC(C)(C)C |
| InChI | InChI=1S/C22H28N2O3/c1-14(27-22(3,4)5)6-7-16-8-9-18-15(2)24(13-17(18)12-16)19-10-11-20(25)23-21(19)26/h8-9,12,19H,1-2,6-7,10-11,13H2,3-5H3,(H,23,25,26) |
| InChIKey | BWAMUQFLMZDNDH-UHFFFAOYSA-N |
| XLogP | 3.54 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.48 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|