C24H21F3N2O3S2 — CID 152811817
3-[3-oxo-6-[3-sulfanylidene-4-[4-(trifluoromethylsulfanyl)phenyl]butyl]-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 152811817) has the molecular formula C24H21F3N2O3S2 and a molecular weight of 506.57 g/mol. Its IUPAC name is 3-[3-oxo-6-[3-sulfanylidene-4-[4-(trifluoromethylsulfanyl)phenyl]butyl]-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-oxo-6-[3-sulfanylidene-4-[4-(trifluoromethylsulfanyl)phenyl]butyl]-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 152811817 |
| Molecular Formula | C24H21F3N2O3S2 |
| Molecular Weight | 506.57 g/mol |
| Exact Mass | 506.09 |
| IUPAC Name | 3-[3-oxo-6-[3-sulfanylidene-4-[4-(trifluoromethylsulfanyl)phenyl]butyl]-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(CCC(=S)Cc4ccc(SC(F)(F)F)cc4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C24H21F3N2O3S2/c25-24(26,27)34-18-6-2-15(3-7-18)12-17(33)5-1-14-4-8-19-16(11-14)13-29(23(19)32)20-9-10-21(30)28-22(20)31/h2-4,6-8,11,20H,1,5,9-10,12-13H2,(H,28,30,31) |
| InChIKey | SRHWGJGIADGQPQ-UHFFFAOYSA-N |
| XLogP | 4.60 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.57 |
| LogP ≤ 5 | 4.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|