C25H22F3NO3S2 — CID 159383067
4-[3-oxo-6-[3-sulfanylidene-4-[4-(trifluoromethylsulfanyl)phenyl]butyl]-1H-isoindol-2-yl]cyclohexane-1,3-dione (PubChem CID 159383067) has the molecular formula C25H22F3NO3S2 and a molecular weight of 505.58 g/mol. Its IUPAC name is 4-[3-oxo-6-[3-sulfanylidene-4-[4-(trifluoromethylsulfanyl)phenyl]butyl]-1H-isoindol-2-yl]cyclohexane-1,3-dione.
| Compound Name | 4-[3-oxo-6-[3-sulfanylidene-4-[4-(trifluoromethylsulfanyl)phenyl]butyl]-1H-isoindol-2-yl]cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 159383067 |
| Molecular Formula | C25H22F3NO3S2 |
| Molecular Weight | 505.58 g/mol |
| Exact Mass | 505.10 |
| IUPAC Name | 4-[3-oxo-6-[3-sulfanylidene-4-[4-(trifluoromethylsulfanyl)phenyl]butyl]-1H-isoindol-2-yl]cyclohexane-1,3-dione |
| SMILES | O=C1CCC(N2Cc3cc(CCC(=S)Cc4ccc(SC(F)(F)F)cc4)ccc3C2=O)C(=O)C1 |
| InChI | InChI=1S/C25H22F3NO3S2/c26-25(27,28)34-20-7-2-16(3-8-20)12-19(33)6-1-15-4-9-21-17(11-15)14-29(24(21)32)22-10-5-18(30)13-23(22)31/h2-4,7-9,11,22H,1,5-6,10,12-14H2 |
| InChIKey | LLDRNCPXXTYTBC-UHFFFAOYSA-N |
| XLogP | 5.49 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.58 |
| LogP ≤ 5 | 5.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|