C32H48N2O6Si — CID 174152505
tert-butyl N-[(1S,2S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[[2-[(1S)-2,4-dioxocyclohexyl]-1-oxo-3H-isoindol-5-yl]methyl]cyclohexyl]carbamate (PubChem CID 174152505) has the molecular formula C32H48N2O6Si and a molecular weight of 584.83 g/mol. Its IUPAC name is tert-butyl N-[(1S,2S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[[2-[(1S)-2,4-dioxocyclohexyl]-1-oxo-3H-isoindol-5-yl]methyl]cyclohexyl]carbamate.
| Compound Name | tert-butyl N-[(1S,2S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[[2-[(1S)-2,4-dioxocyclohexyl]-1-oxo-3H-isoindol-5-yl]methyl]cyclohexyl]carbamate |
|---|---|
| PubChem CID | 174152505 |
| Molecular Formula | C32H48N2O6Si |
| Molecular Weight | 584.83 g/mol |
| Exact Mass | 584.33 |
| IUPAC Name | tert-butyl N-[(1S,2S,4S)-4-[tert-butyl(dimethyl)silyl]oxy-2-[[2-[(1S)-2,4-dioxocyclohexyl]-1-oxo-3H-isoindol-5-yl]methyl]cyclohexyl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1CC[C@H](O[Si](C)(C)C(C)(C)C)C[C@@H]1Cc1ccc2c(c1)CN([C@H]1CCC(=O)CC1=O)C2=O |
| InChI | InChI=1S/C32H48N2O6Si/c1-31(2,3)39-30(38)33-26-13-11-24(40-41(7,8)32(4,5)6)17-21(26)15-20-9-12-25-22(16-20)19-34(29(25)37)27-14-10-23(35)18-28(27)36/h9,12,16,21,24,26-27H,10-11,13-15,17-19H2,1-8H3,(H,33,38)/t21-,24-,26-,27-/m0/s1 |
| InChIKey | AHPGIZRJZUBLQL-OIMINJBOSA-N |
| XLogP | 5.96 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.83 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|