C18H20FNO3 — CID 158282568
4-(6-tert-butyl-5-fluoro-3-oxo-1H-isoindol-2-yl)cyclohexane-1,3-dione (PubChem CID 158282568) has the molecular formula C18H20FNO3 and a molecular weight of 317.36 g/mol. Its IUPAC name is 4-(6-tert-butyl-5-fluoro-3-oxo-1H-isoindol-2-yl)cyclohexane-1,3-dione.
| Compound Name | 4-(6-tert-butyl-5-fluoro-3-oxo-1H-isoindol-2-yl)cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 158282568 |
| Molecular Formula | C18H20FNO3 |
| Molecular Weight | 317.36 g/mol |
| Exact Mass | 317.14 |
| IUPAC Name | 4-(6-tert-butyl-5-fluoro-3-oxo-1H-isoindol-2-yl)cyclohexane-1,3-dione |
| SMILES | CC(C)(C)c1cc2c(cc1F)C(=O)N(C1CCC(=O)CC1=O)C2 |
| InChI | InChI=1S/C18H20FNO3/c1-18(2,3)13-6-10-9-20(17(23)12(10)8-14(13)19)15-5-4-11(21)7-16(15)22/h6,8,15H,4-5,7,9H2,1-3H3 |
| InChIKey | ORWUJFUTDLXYJZ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.36 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|