C20H18F3NO3 — CID 158317734
4-[7-(4,4-difluorocyclohexen-1-yl)-5-fluoro-3-oxo-1H-isoindol-2-yl]cyclohexane-1,3-dione (PubChem CID 158317734) has the molecular formula C20H18F3NO3 and a molecular weight of 377.36 g/mol. Its IUPAC name is 4-[7-(4,4-difluorocyclohexen-1-yl)-5-fluoro-3-oxo-1H-isoindol-2-yl]cyclohexane-1,3-dione.
| Compound Name | 4-[7-(4,4-difluorocyclohexen-1-yl)-5-fluoro-3-oxo-1H-isoindol-2-yl]cyclohexane-1,3-dione |
|---|---|
| PubChem CID | 158317734 |
| Molecular Formula | C20H18F3NO3 |
| Molecular Weight | 377.36 g/mol |
| Exact Mass | 377.12 |
| IUPAC Name | 4-[7-(4,4-difluorocyclohexen-1-yl)-5-fluoro-3-oxo-1H-isoindol-2-yl]cyclohexane-1,3-dione |
| SMILES | O=C1CCC(N2Cc3c(cc(F)cc3C3=CCC(F)(F)CC3)C2=O)C(=O)C1 |
| InChI | InChI=1S/C20H18F3NO3/c21-12-7-14(11-3-5-20(22,23)6-4-11)16-10-24(19(27)15(16)8-12)17-2-1-13(25)9-18(17)26/h3,7-8,17H,1-2,4-6,9-10H2 |
| InChIKey | GOLXBOZCCRVEPU-UHFFFAOYSA-N |
| XLogP | 3.67 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.36 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|