C16H19NO3S — CID 147877970
(4S)-4-(6-oxo-3-propan-2-yl-4H-thieno[3,4-c]pyrrol-5-yl)cycloheptane-1,3-dione (PubChem CID 147877970) has the molecular formula C16H19NO3S and a molecular weight of 305.40 g/mol. Its IUPAC name is (4S)-4-(6-oxo-3-propan-2-yl-4H-thieno[3,4-c]pyrrol-5-yl)cycloheptane-1,3-dione.
| Compound Name | (4S)-4-(6-oxo-3-propan-2-yl-4H-thieno[3,4-c]pyrrol-5-yl)cycloheptane-1,3-dione |
|---|---|
| PubChem CID | 147877970 |
| Molecular Formula | C16H19NO3S |
| Molecular Weight | 305.40 g/mol |
| Exact Mass | 305.11 |
| IUPAC Name | (4S)-4-(6-oxo-3-propan-2-yl-4H-thieno[3,4-c]pyrrol-5-yl)cycloheptane-1,3-dione |
| SMILES | CC(C)c1scc2c1CN([C@H]1CCCC(=O)CC1=O)C2=O |
| InChI | InChI=1S/C16H19NO3S/c1-9(2)15-11-7-17(16(20)12(11)8-21-15)13-5-3-4-10(18)6-14(13)19/h8-9,13H,3-7H2,1-2H3/t13-/m0/s1 |
| InChIKey | HZWOCQASUWRICK-ZDUSSCGKSA-N |
| XLogP | 2.91 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.40 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|