C18H21NO3S — CID 147416337
(4S)-4-(3-cyclopentyl-6-oxo-4H-thieno[3,4-c]pyrrol-5-yl)cycloheptane-1,3-dione (PubChem CID 147416337) has the molecular formula C18H21NO3S and a molecular weight of 331.44 g/mol. Its IUPAC name is (4S)-4-(3-cyclopentyl-6-oxo-4H-thieno[3,4-c]pyrrol-5-yl)cycloheptane-1,3-dione.
| Compound Name | (4S)-4-(3-cyclopentyl-6-oxo-4H-thieno[3,4-c]pyrrol-5-yl)cycloheptane-1,3-dione |
|---|---|
| PubChem CID | 147416337 |
| Molecular Formula | C18H21NO3S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.12 |
| IUPAC Name | (4S)-4-(3-cyclopentyl-6-oxo-4H-thieno[3,4-c]pyrrol-5-yl)cycloheptane-1,3-dione |
| SMILES | O=C1CCC[C@H](N2Cc3c(csc3C3CCCC3)C2=O)C(=O)C1 |
| InChI | InChI=1S/C18H21NO3S/c20-12-6-3-7-15(16(21)8-12)19-9-13-14(18(19)22)10-23-17(13)11-4-1-2-5-11/h10-11,15H,1-9H2/t15-/m0/s1 |
| InChIKey | DRPIUYCZZMHGGZ-HNNXBMFYSA-N |
| XLogP | 3.44 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|