C22H22ClNO5 — CID 162131416
(2Z,4E)-2-(chloromethyl)-6-[[2-[(1S)-2,4-dioxocycloheptyl]-1-oxo-3H-isoindol-4-yl]oxy]hexa-2,4-dienal (PubChem CID 162131416) has the molecular formula C22H22ClNO5 and a molecular weight of 415.87 g/mol. Its IUPAC name is (2Z,4E)-2-(chloromethyl)-6-[[2-[(1S)-2,4-dioxocycloheptyl]-1-oxo-3H-isoindol-4-yl]oxy]hexa-2,4-dienal.
| Compound Name | (2Z,4E)-2-(chloromethyl)-6-[[2-[(1S)-2,4-dioxocycloheptyl]-1-oxo-3H-isoindol-4-yl]oxy]hexa-2,4-dienal |
|---|---|
| PubChem CID | 162131416 |
| Molecular Formula | C22H22ClNO5 |
| Molecular Weight | 415.87 g/mol |
| Exact Mass | 415.12 |
| IUPAC Name | (2Z,4E)-2-(chloromethyl)-6-[[2-[(1S)-2,4-dioxocycloheptyl]-1-oxo-3H-isoindol-4-yl]oxy]hexa-2,4-dienal |
| SMILES | O=C/C(=C/C=C/COc1cccc2c1CN([C@H]1CCCC(=O)CC1=O)C2=O)CCl |
| InChI | InChI=1S/C22H22ClNO5/c23-12-15(14-25)5-1-2-10-29-21-9-4-7-17-18(21)13-24(22(17)28)19-8-3-6-16(26)11-20(19)27/h1-2,4-5,7,9,14,19H,3,6,8,10-13H2/b2-1+,15-5+/t19-/m0/s1 |
| InChIKey | DBSPGFCJVBNWMD-NCULEIJDSA-N |
| XLogP | 3.02 |
| TPSA | 80.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.87 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|