C18H19NO3 — CID 161390148
(4S)-4-(7-cyclopropyl-3-oxo-1H-isoindol-2-yl)cycloheptane-1,3-dione (PubChem CID 161390148) has the molecular formula C18H19NO3 and a molecular weight of 297.35 g/mol. Its IUPAC name is (4S)-4-(7-cyclopropyl-3-oxo-1H-isoindol-2-yl)cycloheptane-1,3-dione.
| Compound Name | (4S)-4-(7-cyclopropyl-3-oxo-1H-isoindol-2-yl)cycloheptane-1,3-dione |
|---|---|
| PubChem CID | 161390148 |
| Molecular Formula | C18H19NO3 |
| Molecular Weight | 297.35 g/mol |
| Exact Mass | 297.14 |
| IUPAC Name | (4S)-4-(7-cyclopropyl-3-oxo-1H-isoindol-2-yl)cycloheptane-1,3-dione |
| SMILES | O=C1CCC[C@H](N2Cc3c(cccc3C3CC3)C2=O)C(=O)C1 |
| InChI | InChI=1S/C18H19NO3/c20-12-3-1-6-16(17(21)9-12)19-10-15-13(11-7-8-11)4-2-5-14(15)18(19)22/h2,4-5,11,16H,1,3,6-10H2/t16-/m0/s1 |
| InChIKey | VSWMWIROMSZYKM-INIZCTEOSA-N |
| XLogP | 2.60 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.35 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|