C24H29ClN4O4S — CID 155467635
(3S)-3-[3-[[[(3-chloro-4-methyl-5-propan-2-ylanilino)-hydroxymethyl]amino]methyl]-6-oxo-4H-thieno[3,4-c]pyrrol-5-yl]azepane-2,7-dione (PubChem CID 155467635) has the molecular formula C24H29ClN4O4S and a molecular weight of 505.04 g/mol. Its IUPAC name is (3S)-3-[3-[[[(3-chloro-4-methyl-5-propan-2-ylanilino)-hydroxymethyl]amino]methyl]-6-oxo-4H-thieno[3,4-c]pyrrol-5-yl]azepane-2,7-dione.
| Compound Name | (3S)-3-[3-[[[(3-chloro-4-methyl-5-propan-2-ylanilino)-hydroxymethyl]amino]methyl]-6-oxo-4H-thieno[3,4-c]pyrrol-5-yl]azepane-2,7-dione |
|---|---|
| PubChem CID | 155467635 |
| Molecular Formula | C24H29ClN4O4S |
| Molecular Weight | 505.04 g/mol |
| Exact Mass | 504.16 |
| IUPAC Name | (3S)-3-[3-[[[(3-chloro-4-methyl-5-propan-2-ylanilino)-hydroxymethyl]amino]methyl]-6-oxo-4H-thieno[3,4-c]pyrrol-5-yl]azepane-2,7-dione |
| SMILES | Cc1c(Cl)cc(NC(O)NCc2scc3c2CN([C@H]2CCCC(=O)NC2=O)C3=O)cc1C(C)C |
| InChI | InChI=1S/C24H29ClN4O4S/c1-12(2)15-7-14(8-18(25)13(15)3)27-24(33)26-9-20-16-10-29(23(32)17(16)11-34-20)19-5-4-6-21(30)28-22(19)31/h7-8,11-12,19,24,26-27,33H,4-6,9-10H2,1-3H3,(H,28,30,31)/t19-,24?/m0/s1 |
| InChIKey | KJOSUXFDZYWWJP-XGLRFROISA-N |
| XLogP | 3.46 |
| TPSA | 110.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.04 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|