C20H20ClN5O3S2 — CID 167082193
1-(6-chloro-5-methyl-2-pyridinyl)-3-[[5-[(3S)-2,7-dioxoazepan-3-yl]-6-oxo-4H-thieno[3,4-c]pyrrol-3-yl]methyl]thiourea (PubChem CID 167082193) has the molecular formula C20H20ClN5O3S2 and a molecular weight of 478.00 g/mol. Its IUPAC name is 1-(6-chloro-5-methyl-2-pyridinyl)-3-[[5-[(3S)-2,7-dioxoazepan-3-yl]-6-oxo-4H-thieno[3,4-c]pyrrol-3-yl]methyl]thiourea.
| Compound Name | 1-(6-chloro-5-methyl-2-pyridinyl)-3-[[5-[(3S)-2,7-dioxoazepan-3-yl]-6-oxo-4H-thieno[3,4-c]pyrrol-3-yl]methyl]thiourea |
|---|---|
| PubChem CID | 167082193 |
| Molecular Formula | C20H20ClN5O3S2 |
| Molecular Weight | 478.00 g/mol |
| Exact Mass | 477.07 |
| IUPAC Name | 1-(6-chloro-5-methyl-2-pyridinyl)-3-[[5-[(3S)-2,7-dioxoazepan-3-yl]-6-oxo-4H-thieno[3,4-c]pyrrol-3-yl]methyl]thiourea |
| SMILES | Cc1ccc(NC(=S)NCc2scc3c2CN([C@H]2CCCC(=O)NC2=O)C3=O)nc1Cl |
| InChI | InChI=1S/C20H20ClN5O3S2/c1-10-5-6-15(23-17(10)21)24-20(30)22-7-14-11-8-26(19(29)12(11)9-31-14)13-3-2-4-16(27)25-18(13)28/h5-6,9,13H,2-4,7-8H2,1H3,(H,25,27,28)(H2,22,23,24,30)/t13-/m0/s1 |
| InChIKey | RZMXBNYFPJAMKJ-ZDUSSCGKSA-N |
| XLogP | 2.74 |
| TPSA | 103.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.00 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|