C28H29F2N3O4 — CID 147491286
3-[6-[4,4-difluoro-3-oxo-4-(3-piperidin-1-ylphenyl)butyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 147491286) has the molecular formula C28H29F2N3O4 and a molecular weight of 509.55 g/mol. Its IUPAC name is 3-[6-[4,4-difluoro-3-oxo-4-(3-piperidin-1-ylphenyl)butyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[4,4-difluoro-3-oxo-4-(3-piperidin-1-ylphenyl)butyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 147491286 |
| Molecular Formula | C28H29F2N3O4 |
| Molecular Weight | 509.55 g/mol |
| Exact Mass | 509.21 |
| IUPAC Name | 3-[6-[4,4-difluoro-3-oxo-4-(3-piperidin-1-ylphenyl)butyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(CCC(=O)C(F)(F)c4cccc(N5CCCCC5)c4)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C28H29F2N3O4/c29-28(30,20-5-4-6-21(16-20)32-13-2-1-3-14-32)24(34)11-8-18-7-9-22-19(15-18)17-33(27(22)37)23-10-12-25(35)31-26(23)36/h4-7,9,15-16,23H,1-3,8,10-14,17H2,(H,31,35,36) |
| InChIKey | FFOOTWQKXDNPFE-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 86.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.55 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|