C24H21ClF2N2O4 — CID 159904770
3-[6-[4-(3-chloro-2-methylphenyl)-4,4-difluoro-3-oxobutyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 159904770) has the molecular formula C24H21ClF2N2O4 and a molecular weight of 474.89 g/mol. Its IUPAC name is 3-[6-[4-(3-chloro-2-methylphenyl)-4,4-difluoro-3-oxobutyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[4-(3-chloro-2-methylphenyl)-4,4-difluoro-3-oxobutyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 159904770 |
| Molecular Formula | C24H21ClF2N2O4 |
| Molecular Weight | 474.89 g/mol |
| Exact Mass | 474.12 |
| IUPAC Name | 3-[6-[4-(3-chloro-2-methylphenyl)-4,4-difluoro-3-oxobutyl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | Cc1c(Cl)cccc1C(F)(F)C(=O)CCc1ccc2c(c1)CN(C1CCC(=O)NC1=O)C2=O |
| InChI | InChI=1S/C24H21ClF2N2O4/c1-13-17(3-2-4-18(13)25)24(26,27)20(30)9-6-14-5-7-16-15(11-14)12-29(23(16)33)19-8-10-21(31)28-22(19)32/h2-5,7,11,19H,6,8-10,12H2,1H3,(H,28,31,32) |
| InChIKey | NWKSSDYWNCGRBA-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.89 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|