C23H19F3N4O4 — CID 170628727
3-[3-oxo-6-[2-oxo-3-[3-(trifluoromethyl)phenyl]imidazolidin-1-yl]-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 170628727) has the molecular formula C23H19F3N4O4 and a molecular weight of 472.42 g/mol. Its IUPAC name is 3-[3-oxo-6-[2-oxo-3-[3-(trifluoromethyl)phenyl]imidazolidin-1-yl]-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[3-oxo-6-[2-oxo-3-[3-(trifluoromethyl)phenyl]imidazolidin-1-yl]-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 170628727 |
| Molecular Formula | C23H19F3N4O4 |
| Molecular Weight | 472.42 g/mol |
| Exact Mass | 472.14 |
| IUPAC Name | 3-[3-oxo-6-[2-oxo-3-[3-(trifluoromethyl)phenyl]imidazolidin-1-yl]-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(N4CCN(c5cccc(C(F)(F)F)c5)C4=O)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C23H19F3N4O4/c24-23(25,26)14-2-1-3-15(11-14)28-8-9-29(22(28)34)16-4-5-17-13(10-16)12-30(21(17)33)18-6-7-19(31)27-20(18)32/h1-5,10-11,18H,6-9,12H2,(H,27,31,32) |
| InChIKey | ORMGJGIHHWULCX-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 90.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.42 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|