C21H24N4O5 — CID 170628756
3-[6-[3-(oxan-4-yl)-2-oxoimidazolidin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione (PubChem CID 170628756) has the molecular formula C21H24N4O5 and a molecular weight of 412.45 g/mol. Its IUPAC name is 3-[6-[3-(oxan-4-yl)-2-oxoimidazolidin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione.
| Compound Name | 3-[6-[3-(oxan-4-yl)-2-oxoimidazolidin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
|---|---|
| PubChem CID | 170628756 |
| Molecular Formula | C21H24N4O5 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | 3-[6-[3-(oxan-4-yl)-2-oxoimidazolidin-1-yl]-3-oxo-1H-isoindol-2-yl]piperidine-2,6-dione |
| SMILES | O=C1CCC(N2Cc3cc(N4CCN(C5CCOCC5)C4=O)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C21H24N4O5/c26-18-4-3-17(19(27)22-18)25-12-13-11-15(1-2-16(13)20(25)28)24-8-7-23(21(24)29)14-5-9-30-10-6-14/h1-2,11,14,17H,3-10,12H2,(H,22,26,27) |
| InChIKey | OEACAKZPZQYLTI-UHFFFAOYSA-N |
| XLogP | 0.87 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 0.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|