C17H24F2N2S — CID 56574762
1-[[4-(difluoromethylsulfanyl)phenyl]methyl]-2-(pyrrolidin-1-ylmethyl)pyrrolidine (PubChem CID 56574762) has the molecular formula C17H24F2N2S and a molecular weight of 326.46 g/mol. Its IUPAC name is 1-[[4-(difluoromethylsulfanyl)phenyl]methyl]-2-(pyrrolidin-1-ylmethyl)pyrrolidine.
| Compound Name | 1-[[4-(difluoromethylsulfanyl)phenyl]methyl]-2-(pyrrolidin-1-ylmethyl)pyrrolidine |
|---|---|
| PubChem CID | 56574762 |
| Molecular Formula | C17H24F2N2S |
| Molecular Weight | 326.46 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | 1-[[4-(difluoromethylsulfanyl)phenyl]methyl]-2-(pyrrolidin-1-ylmethyl)pyrrolidine |
| SMILES | FC(F)Sc1ccc(CN2CCCC2CN2CCCC2)cc1 |
| InChI | InChI=1S/C17H24F2N2S/c18-17(19)22-16-7-5-14(6-8-16)12-21-11-3-4-15(21)13-20-9-1-2-10-20/h5-8,15,17H,1-4,9-13H2 |
| InChIKey | MVTJOLCOXYHSEI-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.46 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |