C21H28FN3O2 — CID 174200992
5-(6-amino-5-fluoro-5-methylhexyl)-2-(6-methylidene-2-oxopiperidin-3-yl)-3H-isoindol-1-one (PubChem CID 174200992) has the molecular formula C21H28FN3O2 and a molecular weight of 373.47 g/mol. Its IUPAC name is 5-(6-amino-5-fluoro-5-methylhexyl)-2-(6-methylidene-2-oxopiperidin-3-yl)-3H-isoindol-1-one.
| Compound Name | 5-(6-amino-5-fluoro-5-methylhexyl)-2-(6-methylidene-2-oxopiperidin-3-yl)-3H-isoindol-1-one |
|---|---|
| PubChem CID | 174200992 |
| Molecular Formula | C21H28FN3O2 |
| Molecular Weight | 373.47 g/mol |
| Exact Mass | 373.22 |
| IUPAC Name | 5-(6-amino-5-fluoro-5-methylhexyl)-2-(6-methylidene-2-oxopiperidin-3-yl)-3H-isoindol-1-one |
| SMILES | C=C1CCC(N2Cc3cc(CCCCC(C)(F)CN)ccc3C2=O)C(=O)N1 |
| InChI | InChI=1S/C21H28FN3O2/c1-14-6-9-18(19(26)24-14)25-12-16-11-15(7-8-17(16)20(25)27)5-3-4-10-21(2,22)13-23/h7-8,11,18H,1,3-6,9-10,12-13,23H2,2H3,(H,24,26) |
| InChIKey | XBDNJSHDGSQDOO-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 75.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.47 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|