C20H14BrF2N3O — CID 174201202
2-(6-bromo-3-fluoro-2-pyridinyl)-1-[2-(6-fluoro-1,2-benzoxazol-3-yl)phenyl]ethanamine (PubChem CID 174201202) has the molecular formula C20H14BrF2N3O and a molecular weight of 430.25 g/mol. Its IUPAC name is 2-(6-bromo-3-fluoro-2-pyridinyl)-1-[2-(6-fluoro-1,2-benzoxazol-3-yl)phenyl]ethanamine.
| Compound Name | 2-(6-bromo-3-fluoro-2-pyridinyl)-1-[2-(6-fluoro-1,2-benzoxazol-3-yl)phenyl]ethanamine |
|---|---|
| PubChem CID | 174201202 |
| Molecular Formula | C20H14BrF2N3O |
| Molecular Weight | 430.25 g/mol |
| Exact Mass | 429.03 |
| IUPAC Name | 2-(6-bromo-3-fluoro-2-pyridinyl)-1-[2-(6-fluoro-1,2-benzoxazol-3-yl)phenyl]ethanamine |
| SMILES | NC(Cc1nc(Br)ccc1F)c1ccccc1-c1noc2cc(F)ccc12 |
| InChI | InChI=1S/C20H14BrF2N3O/c21-19-8-7-15(23)17(25-19)10-16(24)12-3-1-2-4-13(12)20-14-6-5-11(22)9-18(14)27-26-20/h1-9,16H,10,24H2 |
| InChIKey | FGAIWPGMADGMNL-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 64.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.25 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|