About 1-[2-(1,2-benzoxazol-3-yl)phenyl]-2-(4-fluorophenyl)ethanamine;hydrochloride
1-[2-(1,2-benzoxazol-3-yl)phenyl]-2-(4-fluorophenyl)ethanamine;hydrochloride (PubChem CID 18357475) has the molecular formula C21H18ClFN2O
and a molecular weight of 368.84 g/mol. Its IUPAC name is 1-[2-(1,2-benzoxazol-3-yl)phenyl]-2-(4-fluorophenyl)ethanamine;hydrochloride.
Molecular Properties
| Compound Name | 1-[2-(1,2-benzoxazol-3-yl)phenyl]-2-(4-fluorophenyl)ethanamine;hydrochloride |
| PubChem CID | 18357475 |
| Molecular Formula | C21H18ClFN2O |
| Molecular Weight | 368.84 g/mol |
| Exact Mass | 368.11 |
| IUPAC Name | 1-[2-(1,2-benzoxazol-3-yl)phenyl]-2-(4-fluorophenyl)ethanamine;hydrochloride |
| SMILES | Cl.NC(Cc1ccc(F)cc1)c1ccccc1-c1noc2ccccc12 |
| InChI | InChI=1S/C21H17FN2O.ClH/c22-15-11-9-14(10-12-15)13-19(23)16-5-1-2-6-17(16)21-18-7-3-4-8-20(18)25-24-21;/h1-12,19H,13,23H2;1H |
| InChIKey | KKVIGLAEPYIGJS-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 368.84 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-[2-(1,2-benzoxazol-3-yl)phenyl]-2-(4-fluorophenyl)ethanamine;hydrochloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[2-(1,2-benzoxazol-3-yl)phenyl]-2-(4-fluorophenyl)ethanamine;hydrochloride?
The IUPAC name of 1-[2-(1,2-benzoxazol-3-yl)phenyl]-2-(4-fluorophenyl)ethanamine;hydrochloride (CID 18357475) is 1-[2-(1,2-benzoxazol-3-yl)phenyl]-2-(4-fluorophenyl)ethanamine;hydrochloride.
What is the SMILES notation for 1-[2-(1,2-benzoxazol-3-yl)phenyl]-2-(4-fluorophenyl)ethanamine;hydrochloride?
The canonical SMILES for 1-[2-(1,2-benzoxazol-3-yl)phenyl]-2-(4-fluorophenyl)ethanamine;hydrochloride is Cl.NC(Cc1ccc(F)cc1)c1ccccc1-c1noc2ccccc12.
What is the InChIKey of 1-[2-(1,2-benzoxazol-3-yl)phenyl]-2-(4-fluorophenyl)ethanamine;hydrochloride?
The InChIKey is KKVIGLAEPYIGJS-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H17FN2O.ClH/c22-15-11-9-14(10-12-15)13-19(23)16-5-1-2-6-17(16)21-18-7-3-4-8-20(18)25-24-21;/h1-12,19H,13,23H2;1H.
What are the key properties of 1-[2-(1,2-benzoxazol-3-yl)phenyl]-2-(4-fluorophenyl)ethanamine;hydrochloride?
1-[2-(1,2-benzoxazol-3-yl)phenyl]-2-(4-fluorophenyl)ethanamine;hydrochloride has a molecular weight of 368.84 g/mol, XLogP of 5.30, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[2-(1,2-benzoxazol-3-yl)phenyl]-2-(4-fluorophenyl)ethanamine;hydrochloride is sourced from PubChem (CID 18357475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).