C17H15FN2O — CID 15524035
1-[2-(1,2-benzoxazol-3-yl)-5-fluorophenyl]but-3-en-1-amine (PubChem CID 15524035) has the molecular formula C17H15FN2O and a molecular weight of 282.32 g/mol. Its IUPAC name is 1-[2-(1,2-benzoxazol-3-yl)-5-fluorophenyl]but-3-en-1-amine.
| Compound Name | 1-[2-(1,2-benzoxazol-3-yl)-5-fluorophenyl]but-3-en-1-amine |
|---|---|
| PubChem CID | 15524035 |
| Molecular Formula | C17H15FN2O |
| Molecular Weight | 282.32 g/mol |
| Exact Mass | 282.12 |
| IUPAC Name | 1-[2-(1,2-benzoxazol-3-yl)-5-fluorophenyl]but-3-en-1-amine |
| SMILES | C=CCC(N)c1cc(F)ccc1-c1noc2ccccc12 |
| InChI | InChI=1S/C17H15FN2O/c1-2-5-15(19)14-10-11(18)8-9-12(14)17-13-6-3-4-7-16(13)21-20-17/h2-4,6-10,15H,1,5,19H2 |
| InChIKey | XZAAECPJAZTCCG-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 52.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.32 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|