About [2-(1,2-benzoxazol-3-yl)-5-fluorophenyl]methanamine;(E)-2-prop-2-enylbut-2-enedioic acid
[2-(1,2-benzoxazol-3-yl)-5-fluorophenyl]methanamine;(E)-2-prop-2-enylbut-2-enedioic acid (PubChem CID 67437105) has the molecular formula C21H19FN2O5
and a molecular weight of 398.39 g/mol. Its IUPAC name is [2-(1,2-benzoxazol-3-yl)-5-fluorophenyl]methanamine;(E)-2-prop-2-enylbut-2-enedioic acid.
Molecular Properties
| Compound Name | [2-(1,2-benzoxazol-3-yl)-5-fluorophenyl]methanamine;(E)-2-prop-2-enylbut-2-enedioic acid |
| PubChem CID | 67437105 |
| Molecular Formula | C21H19FN2O5 |
| Molecular Weight | 398.39 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | [2-(1,2-benzoxazol-3-yl)-5-fluorophenyl]methanamine;(E)-2-prop-2-enylbut-2-enedioic acid |
| SMILES | C=CC/C(=C\C(=O)O)C(=O)O.NCc1cc(F)ccc1-c1noc2ccccc12 |
| InChI | InChI=1S/C14H11FN2O.C7H8O4/c15-10-5-6-11(9(7-10)8-16)14-12-3-1-2-4-13(12)18-17-14;1-2-3-5(7(10)11)4-6(8)9/h1-7H,8,16H2;2,4H,1,3H2,(H,8,9)(H,10,11)/b;5-4+ |
| InChIKey | CBZCZUDRZGOEKI-RCKHEGBHSA-N |
| XLogP | 3.75 |
| TPSA | 126.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 398.39 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze [2-(1,2-benzoxazol-3-yl)-5-fluorophenyl]methanamine;(E)-2-prop-2-enylbut-2-enedioic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-(1,2-benzoxazol-3-yl)-5-fluorophenyl]methanamine;(E)-2-prop-2-enylbut-2-enedioic acid?
The IUPAC name of [2-(1,2-benzoxazol-3-yl)-5-fluorophenyl]methanamine;(E)-2-prop-2-enylbut-2-enedioic acid (CID 67437105) is [2-(1,2-benzoxazol-3-yl)-5-fluorophenyl]methanamine;(E)-2-prop-2-enylbut-2-enedioic acid.
What is the SMILES notation for [2-(1,2-benzoxazol-3-yl)-5-fluorophenyl]methanamine;(E)-2-prop-2-enylbut-2-enedioic acid?
The canonical SMILES for [2-(1,2-benzoxazol-3-yl)-5-fluorophenyl]methanamine;(E)-2-prop-2-enylbut-2-enedioic acid is C=CC/C(=C\C(=O)O)C(=O)O.NCc1cc(F)ccc1-c1noc2ccccc12.
What is the InChIKey of [2-(1,2-benzoxazol-3-yl)-5-fluorophenyl]methanamine;(E)-2-prop-2-enylbut-2-enedioic acid?
The InChIKey is CBZCZUDRZGOEKI-RCKHEGBHSA-N. The full InChI is InChI=1S/C14H11FN2O.C7H8O4/c15-10-5-6-11(9(7-10)8-16)14-12-3-1-2-4-13(12)18-17-14;1-2-3-5(7(10)11)4-6(8)9/h1-7H,8,16H2;2,4H,1,3H2,(H,8,9)(H,10,11)/b;5-4+.
What are the key properties of [2-(1,2-benzoxazol-3-yl)-5-fluorophenyl]methanamine;(E)-2-prop-2-enylbut-2-enedioic acid?
[2-(1,2-benzoxazol-3-yl)-5-fluorophenyl]methanamine;(E)-2-prop-2-enylbut-2-enedioic acid has a molecular weight of 398.39 g/mol, XLogP of 3.75, 6 rotatable bonds, 3 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-(1,2-benzoxazol-3-yl)-5-fluorophenyl]methanamine;(E)-2-prop-2-enylbut-2-enedioic acid is sourced from PubChem (CID 67437105), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).