C21H19FN2O5 — CID 67437105
[2-(1,2-benzoxazol-3-yl)-5-fluorophenyl]methanamine;(E)-2-prop-2-enylbut-2-enedioic acid (PubChem CID 67437105) has the molecular formula C21H19FN2O5 and a molecular weight of 398.39 g/mol. Its IUPAC name is [2-(1,2-benzoxazol-3-yl)-5-fluorophenyl]methanamine;(E)-2-prop-2-enylbut-2-enedioic acid.
| Compound Name | [2-(1,2-benzoxazol-3-yl)-5-fluorophenyl]methanamine;(E)-2-prop-2-enylbut-2-enedioic acid |
|---|---|
| PubChem CID | 67437105 |
| Molecular Formula | C21H19FN2O5 |
| Molecular Weight | 398.39 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | [2-(1,2-benzoxazol-3-yl)-5-fluorophenyl]methanamine;(E)-2-prop-2-enylbut-2-enedioic acid |
| SMILES | C=CC/C(=C\C(=O)O)C(=O)O.NCc1cc(F)ccc1-c1noc2ccccc12 |
| InChI | InChI=1S/C14H11FN2O.C7H8O4/c15-10-5-6-11(9(7-10)8-16)14-12-3-1-2-4-13(12)18-17-14;1-2-3-5(7(10)11)4-6(8)9/h1-7H,8,16H2;2,4H,1,3H2,(H,8,9)(H,10,11)/b;5-4+ |
| InChIKey | CBZCZUDRZGOEKI-RCKHEGBHSA-N |
| XLogP | 3.75 |
| TPSA | 126.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.39 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|