C22H24N2O3 — CID 139834953
(2S)-2-[1-[2-(1,2-benzoxazol-3-yl)phenyl]but-3-enylamino]-3-methylbutanoic acid (PubChem CID 139834953) has the molecular formula C22H24N2O3 and a molecular weight of 364.45 g/mol. Its IUPAC name is (2S)-2-[1-[2-(1,2-benzoxazol-3-yl)phenyl]but-3-enylamino]-3-methylbutanoic acid.
| Compound Name | (2S)-2-[1-[2-(1,2-benzoxazol-3-yl)phenyl]but-3-enylamino]-3-methylbutanoic acid |
|---|---|
| PubChem CID | 139834953 |
| Molecular Formula | C22H24N2O3 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | (2S)-2-[1-[2-(1,2-benzoxazol-3-yl)phenyl]but-3-enylamino]-3-methylbutanoic acid |
| SMILES | C=CCC(N[C@H](C(=O)O)C(C)C)c1ccccc1-c1noc2ccccc12 |
| InChI | InChI=1S/C22H24N2O3/c1-4-9-18(23-20(14(2)3)22(25)26)15-10-5-6-11-16(15)21-17-12-7-8-13-19(17)27-24-21/h4-8,10-14,18,20,23H,1,9H2,2-3H3,(H,25,26)/t18?,20-/m0/s1 |
| InChIKey | CNSNSJUWNXTEAA-IJHRGXPZSA-N |
| XLogP | 4.81 |
| TPSA | 75.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|