About [1-[2-(1,2-benzoxazol-3-yl)phenyl]-2-(6-methoxy-2-pyridinyl)ethyl]carbamic acid
[1-[2-(1,2-benzoxazol-3-yl)phenyl]-2-(6-methoxy-2-pyridinyl)ethyl]carbamic acid (PubChem CID 174200276) has the molecular formula C22H19N3O4
and a molecular weight of 389.41 g/mol. Its IUPAC name is [1-[2-(1,2-benzoxazol-3-yl)phenyl]-2-(6-methoxy-2-pyridinyl)ethyl]carbamic acid.
Molecular Properties
| Compound Name | [1-[2-(1,2-benzoxazol-3-yl)phenyl]-2-(6-methoxy-2-pyridinyl)ethyl]carbamic acid |
| PubChem CID | 174200276 |
| Molecular Formula | C22H19N3O4 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.14 |
| IUPAC Name | [1-[2-(1,2-benzoxazol-3-yl)phenyl]-2-(6-methoxy-2-pyridinyl)ethyl]carbamic acid |
| SMILES | COc1cccc(CC(NC(=O)O)c2ccccc2-c2noc3ccccc23)n1 |
| InChI | InChI=1S/C22H19N3O4/c1-28-20-12-6-7-14(23-20)13-18(24-22(26)27)15-8-2-3-9-16(15)21-17-10-4-5-11-19(17)29-25-21/h2-12,18,24H,13H2,1H3,(H,26,27) |
| InChIKey | XJIPYYXHPMHPSQ-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 97.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [1-[2-(1,2-benzoxazol-3-yl)phenyl]-2-(6-methoxy-2-pyridinyl)ethyl]carbamic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-[2-(1,2-benzoxazol-3-yl)phenyl]-2-(6-methoxy-2-pyridinyl)ethyl]carbamic acid?
The IUPAC name of [1-[2-(1,2-benzoxazol-3-yl)phenyl]-2-(6-methoxy-2-pyridinyl)ethyl]carbamic acid (CID 174200276) is [1-[2-(1,2-benzoxazol-3-yl)phenyl]-2-(6-methoxy-2-pyridinyl)ethyl]carbamic acid.
What is the SMILES notation for [1-[2-(1,2-benzoxazol-3-yl)phenyl]-2-(6-methoxy-2-pyridinyl)ethyl]carbamic acid?
The canonical SMILES for [1-[2-(1,2-benzoxazol-3-yl)phenyl]-2-(6-methoxy-2-pyridinyl)ethyl]carbamic acid is COc1cccc(CC(NC(=O)O)c2ccccc2-c2noc3ccccc23)n1.
What is the InChIKey of [1-[2-(1,2-benzoxazol-3-yl)phenyl]-2-(6-methoxy-2-pyridinyl)ethyl]carbamic acid?
The InChIKey is XJIPYYXHPMHPSQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H19N3O4/c1-28-20-12-6-7-14(23-20)13-18(24-22(26)27)15-8-2-3-9-16(15)21-17-10-4-5-11-19(17)29-25-21/h2-12,18,24H,13H2,1H3,(H,26,27).
What are the key properties of [1-[2-(1,2-benzoxazol-3-yl)phenyl]-2-(6-methoxy-2-pyridinyl)ethyl]carbamic acid?
[1-[2-(1,2-benzoxazol-3-yl)phenyl]-2-(6-methoxy-2-pyridinyl)ethyl]carbamic acid has a molecular weight of 389.41 g/mol, XLogP of 4.45, 6 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [1-[2-(1,2-benzoxazol-3-yl)phenyl]-2-(6-methoxy-2-pyridinyl)ethyl]carbamic acid is sourced from PubChem (CID 174200276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).