C26H28N4O3S — CID 174160797
[[(1S)-1-[2-(1,2-benzoxazol-3-yl)phenyl]-2-[6-(methylcarbamoyl)-2-pyridinyl]ethyl]amino]-tert-butyl-oxidosulfanium (PubChem CID 174160797) has the molecular formula C26H28N4O3S and a molecular weight of 476.60 g/mol. Its IUPAC name is [[(1S)-1-[2-(1,2-benzoxazol-3-yl)phenyl]-2-[6-(methylcarbamoyl)-2-pyridinyl]ethyl]amino]-tert-butyl-oxidosulfanium.
| Compound Name | [[(1S)-1-[2-(1,2-benzoxazol-3-yl)phenyl]-2-[6-(methylcarbamoyl)-2-pyridinyl]ethyl]amino]-tert-butyl-oxidosulfanium |
|---|---|
| PubChem CID | 174160797 |
| Molecular Formula | C26H28N4O3S |
| Molecular Weight | 476.60 g/mol |
| Exact Mass | 476.19 |
| IUPAC Name | [[(1S)-1-[2-(1,2-benzoxazol-3-yl)phenyl]-2-[6-(methylcarbamoyl)-2-pyridinyl]ethyl]amino]-tert-butyl-oxidosulfanium |
| SMILES | CNC(=O)c1cccc(C[C@H](N[S+]([O-])C(C)(C)C)c2ccccc2-c2noc3ccccc23)n1 |
| InChI | InChI=1S/C26H28N4O3S/c1-26(2,3)34(32)30-22(16-17-10-9-14-21(28-17)25(31)27-4)18-11-5-6-12-19(18)24-20-13-7-8-15-23(20)33-29-24/h5-15,22,30H,16H2,1-4H3,(H,27,31)/t22-,34?/m0/s1 |
| InChIKey | UGLCDCWUXOFJTA-DAXAVGQISA-N |
| XLogP | 4.59 |
| TPSA | 103.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.60 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|