C25H26BrN3O2S — CID 174160784
[[(1S)-1-[2-(1,2-benzoxazol-3-yl)phenyl]-2-(6-bromo-3-methyl-2-pyridinyl)ethyl]amino]-tert-butyl-oxidosulfanium (PubChem CID 174160784) has the molecular formula C25H26BrN3O2S and a molecular weight of 512.47 g/mol. Its IUPAC name is [[(1S)-1-[2-(1,2-benzoxazol-3-yl)phenyl]-2-(6-bromo-3-methyl-2-pyridinyl)ethyl]amino]-tert-butyl-oxidosulfanium.
| Compound Name | [[(1S)-1-[2-(1,2-benzoxazol-3-yl)phenyl]-2-(6-bromo-3-methyl-2-pyridinyl)ethyl]amino]-tert-butyl-oxidosulfanium |
|---|---|
| PubChem CID | 174160784 |
| Molecular Formula | C25H26BrN3O2S |
| Molecular Weight | 512.47 g/mol |
| Exact Mass | 511.09 |
| IUPAC Name | [[(1S)-1-[2-(1,2-benzoxazol-3-yl)phenyl]-2-(6-bromo-3-methyl-2-pyridinyl)ethyl]amino]-tert-butyl-oxidosulfanium |
| SMILES | Cc1ccc(Br)nc1C[C@H](N[S+]([O-])C(C)(C)C)c1ccccc1-c1noc2ccccc12 |
| InChI | InChI=1S/C25H26BrN3O2S/c1-16-13-14-23(26)27-20(16)15-21(29-32(30)25(2,3)4)17-9-5-6-10-18(17)24-19-11-7-8-12-22(19)31-28-24/h5-14,21,29H,15H2,1-4H3/t21-,32?/m0/s1 |
| InChIKey | IGIPLHLTJHAZHQ-GIFGLUKTSA-N |
| XLogP | 6.30 |
| TPSA | 74.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.47 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|