C27H30Br2FN3O2SSi — CID 174200604
[[1-[2-(6-bromo-1,2-benzoxazol-3-yl)phenyl]-2-(6-bromo-3-fluoro-4-trimethylsilyl-2-pyridinyl)ethyl]amino]-tert-butyl-oxidosulfanium (PubChem CID 174200604) has the molecular formula C27H30Br2FN3O2SSi and a molecular weight of 667.52 g/mol. Its IUPAC name is [[1-[2-(6-bromo-1,2-benzoxazol-3-yl)phenyl]-2-(6-bromo-3-fluoro-4-trimethylsilyl-2-pyridinyl)ethyl]amino]-tert-butyl-oxidosulfanium.
| Compound Name | [[1-[2-(6-bromo-1,2-benzoxazol-3-yl)phenyl]-2-(6-bromo-3-fluoro-4-trimethylsilyl-2-pyridinyl)ethyl]amino]-tert-butyl-oxidosulfanium |
|---|---|
| PubChem CID | 174200604 |
| Molecular Formula | C27H30Br2FN3O2SSi |
| Molecular Weight | 667.52 g/mol |
| Exact Mass | 665.02 |
| IUPAC Name | [[1-[2-(6-bromo-1,2-benzoxazol-3-yl)phenyl]-2-(6-bromo-3-fluoro-4-trimethylsilyl-2-pyridinyl)ethyl]amino]-tert-butyl-oxidosulfanium |
| SMILES | CC(C)(C)[S+]([O-])NC(Cc1nc(Br)cc([Si](C)(C)C)c1F)c1ccccc1-c1noc2cc(Br)ccc12 |
| InChI | InChI=1S/C27H30Br2FN3O2SSi/c1-27(2,3)36(34)33-20(14-21-25(30)23(37(4,5)6)15-24(29)31-21)17-9-7-8-10-18(17)26-19-12-11-16(28)13-22(19)35-32-26/h7-13,15,20,33H,14H2,1-6H3 |
| InChIKey | HWCDGPBDPSJBOT-UHFFFAOYSA-N |
| XLogP | 7.43 |
| TPSA | 74.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.52 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|