C27H30BrF2N3O2SSi — CID 174160749
[[(1S)-2-(6-bromo-3-fluoro-4-trimethylsilyl-2-pyridinyl)-1-[2-(7-fluoro-1,2-benzoxazol-3-yl)phenyl]ethyl]amino]-tert-butyl-oxidosulfanium (PubChem CID 174160749) has the molecular formula C27H30BrF2N3O2SSi and a molecular weight of 606.61 g/mol. Its IUPAC name is [[(1S)-2-(6-bromo-3-fluoro-4-trimethylsilyl-2-pyridinyl)-1-[2-(7-fluoro-1,2-benzoxazol-3-yl)phenyl]ethyl]amino]-tert-butyl-oxidosulfanium.
| Compound Name | [[(1S)-2-(6-bromo-3-fluoro-4-trimethylsilyl-2-pyridinyl)-1-[2-(7-fluoro-1,2-benzoxazol-3-yl)phenyl]ethyl]amino]-tert-butyl-oxidosulfanium |
|---|---|
| PubChem CID | 174160749 |
| Molecular Formula | C27H30BrF2N3O2SSi |
| Molecular Weight | 606.61 g/mol |
| Exact Mass | 605.10 |
| IUPAC Name | [[(1S)-2-(6-bromo-3-fluoro-4-trimethylsilyl-2-pyridinyl)-1-[2-(7-fluoro-1,2-benzoxazol-3-yl)phenyl]ethyl]amino]-tert-butyl-oxidosulfanium |
| SMILES | CC(C)(C)[S+]([O-])N[C@@H](Cc1nc(Br)cc([Si](C)(C)C)c1F)c1ccccc1-c1noc2c(F)cccc12 |
| InChI | InChI=1S/C27H30BrF2N3O2SSi/c1-27(2,3)36(34)33-20(14-21-24(30)22(37(4,5)6)15-23(28)31-21)16-10-7-8-11-17(16)25-18-12-9-13-19(29)26(18)35-32-25/h7-13,15,20,33H,14H2,1-6H3/t20-,36?/m0/s1 |
| InChIKey | TTXUOVLIUBPQIR-PIPNLDLUSA-N |
| XLogP | 6.81 |
| TPSA | 74.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 606.61 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|