C26H29N3O2S — CID 174200828
[[(1S)-1-[2-(1,2-benzoxazol-3-yl)phenyl]-2-pyridin-2-ylbutyl]amino]-tert-butyl-oxidosulfanium (PubChem CID 174200828) has the molecular formula C26H29N3O2S and a molecular weight of 447.60 g/mol. Its IUPAC name is [[(1S)-1-[2-(1,2-benzoxazol-3-yl)phenyl]-2-pyridin-2-ylbutyl]amino]-tert-butyl-oxidosulfanium.
| Compound Name | [[(1S)-1-[2-(1,2-benzoxazol-3-yl)phenyl]-2-pyridin-2-ylbutyl]amino]-tert-butyl-oxidosulfanium |
|---|---|
| PubChem CID | 174200828 |
| Molecular Formula | C26H29N3O2S |
| Molecular Weight | 447.60 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | [[(1S)-1-[2-(1,2-benzoxazol-3-yl)phenyl]-2-pyridin-2-ylbutyl]amino]-tert-butyl-oxidosulfanium |
| SMILES | CCC(c1ccccn1)[C@H](N[S+]([O-])C(C)(C)C)c1ccccc1-c1noc2ccccc12 |
| InChI | InChI=1S/C26H29N3O2S/c1-5-18(22-15-10-11-17-27-22)25(29-32(30)26(2,3)4)20-13-7-6-12-19(20)24-21-14-8-9-16-23(21)31-28-24/h6-18,25,29H,5H2,1-4H3/t18?,25-,32?/m0/s1 |
| InChIKey | CEEICPMDNQVTSV-WGVQCCMTSA-N |
| XLogP | 6.18 |
| TPSA | 74.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.60 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'charged_oxygen_or_sulfur_atoms', 'substructure': 'N/A'} |
|---|