C23H25FN2O3 — CID 54180205
methyl (2S)-2-[[(1S)-1-[2-(6-fluoro-1,2-benzoxazol-3-yl)phenyl]but-3-enyl]amino]-3-methylbutanoate (PubChem CID 54180205) has the molecular formula C23H25FN2O3 and a molecular weight of 396.46 g/mol. Its IUPAC name is methyl (2S)-2-[[(1S)-1-[2-(6-fluoro-1,2-benzoxazol-3-yl)phenyl]but-3-enyl]amino]-3-methylbutanoate.
| Compound Name | methyl (2S)-2-[[(1S)-1-[2-(6-fluoro-1,2-benzoxazol-3-yl)phenyl]but-3-enyl]amino]-3-methylbutanoate |
|---|---|
| PubChem CID | 54180205 |
| Molecular Formula | C23H25FN2O3 |
| Molecular Weight | 396.46 g/mol |
| Exact Mass | 396.18 |
| IUPAC Name | methyl (2S)-2-[[(1S)-1-[2-(6-fluoro-1,2-benzoxazol-3-yl)phenyl]but-3-enyl]amino]-3-methylbutanoate |
| SMILES | C=CC[C@H](N[C@H](C(=O)OC)C(C)C)c1ccccc1-c1noc2cc(F)ccc12 |
| InChI | InChI=1S/C23H25FN2O3/c1-5-8-19(25-21(14(2)3)23(27)28-4)16-9-6-7-10-17(16)22-18-12-11-15(24)13-20(18)29-26-22/h5-7,9-14,19,21,25H,1,8H2,2-4H3/t19-,21-/m0/s1 |
| InChIKey | PBGLBDIRSXCXRX-FPOVZHCZSA-N |
| XLogP | 5.04 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.46 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|