C21H19FN2O5 — CID 159552619
(1S)-1-[2-(1,2-benzoxazol-3-yl)-4-fluorophenyl]but-3-en-1-amine;(E)-but-2-enedioic acid (PubChem CID 159552619) has the molecular formula C21H19FN2O5 and a molecular weight of 398.39 g/mol. Its IUPAC name is (1S)-1-[2-(1,2-benzoxazol-3-yl)-4-fluorophenyl]but-3-en-1-amine;(E)-but-2-enedioic acid.
| Compound Name | (1S)-1-[2-(1,2-benzoxazol-3-yl)-4-fluorophenyl]but-3-en-1-amine;(E)-but-2-enedioic acid |
|---|---|
| PubChem CID | 159552619 |
| Molecular Formula | C21H19FN2O5 |
| Molecular Weight | 398.39 g/mol |
| Exact Mass | 398.13 |
| IUPAC Name | (1S)-1-[2-(1,2-benzoxazol-3-yl)-4-fluorophenyl]but-3-en-1-amine;(E)-but-2-enedioic acid |
| SMILES | C=CC[C@H](N)c1ccc(F)cc1-c1noc2ccccc12.O=C(O)/C=C/C(=O)O |
| InChI | InChI=1S/C17H15FN2O.C4H4O4/c1-2-5-15(19)12-9-8-11(18)10-14(12)17-13-6-3-4-7-16(13)21-20-17;5-3(6)1-2-4(7)8/h2-4,6-10,15H,1,5,19H2;1-2H,(H,5,6)(H,7,8)/b;2-1+/t15-;/m0./s1 |
| InChIKey | MFOVJVCJIWVUAE-YAKGRJRBSA-N |
| XLogP | 3.92 |
| TPSA | 126.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.39 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|